C20H34O4 — CID 16654
1,3-bis(2-tert-butylperoxypropan-2-yl)benzene (PubChem CID 16654) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 1,3-bis(2-tert-butylperoxypropan-2-yl)benzene.
| Compound Name | 1,3-bis(2-tert-butylperoxypropan-2-yl)benzene |
|---|---|
| PubChem CID | 16654 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1,3-bis(2-tert-butylperoxypropan-2-yl)benzene |
| SMILES | CC(C)(C)OOC(C)(C)c1cccc(C(C)(C)OOC(C)(C)C)c1 |
| InChI | InChI=1S/C20H34O4/c1-17(2,3)21-23-19(7,8)15-12-11-13-16(14-15)20(9,10)24-22-18(4,5)6/h11-14H,1-10H3 |
| InChIKey | UBRWPVTUQDJKCC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|