About ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate
ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate (PubChem CID 16654012) has the molecular formula C15H24N4O5
and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate.
Molecular Properties
| Compound Name | ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate |
| PubChem CID | 16654012 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)c1c(N)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H24N4O5/c1-4-24-10(20)8-6-5-7-9-17-13(21)11-12(16)18(2)15(23)19(3)14(11)22/h4-9,16H2,1-3H3,(H,17,21) |
| InChIKey | HJFBDPDFUIIZHP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate?
The IUPAC name of ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate (CID 16654012) is ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate.
What is the SMILES notation for ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate?
The canonical SMILES for ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate is CCOC(=O)CCCCCNC(=O)c1c(N)n(C)c(=O)n(C)c1=O.
What is the InChIKey of ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate?
The InChIKey is HJFBDPDFUIIZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O5/c1-4-24-10(20)8-6-5-7-9-17-13(21)11-12(16)18(2)15(23)19(3)14(11)22/h4-9,16H2,1-3H3,(H,17,21).
What are the key properties of ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate?
ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate has a molecular weight of 340.38 g/mol, XLogP of -0.48, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(4-amino-1,3-dimethyl-2,6-dioxopyrimidine-5-carbonyl)amino]hexanoate is sourced from PubChem (CID 16654012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).