About 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea
1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea (PubChem CID 16654058) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea |
| PubChem CID | 16654058 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea |
| SMILES | Cc1nc(NC(=O)NC(C)C)sc1C |
| InChI | InChI=1S/C9H15N3OS/c1-5(2)10-8(13)12-9-11-6(3)7(4)14-9/h5H,1-4H3,(H2,10,11,12,13) |
| InChIKey | RCJWNGJUTSHJOI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea?
The IUPAC name of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea (CID 16654058) is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea.
What is the SMILES notation for 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea?
The canonical SMILES for 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea is Cc1nc(NC(=O)NC(C)C)sc1C.
What is the InChIKey of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea?
The InChIKey is RCJWNGJUTSHJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS/c1-5(2)10-8(13)12-9-11-6(3)7(4)14-9/h5H,1-4H3,(H2,10,11,12,13).
What are the key properties of 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea?
1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea has a molecular weight of 213.31 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-propan-2-ylurea is sourced from PubChem (CID 16654058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).