About 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide
2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide (PubChem CID 166541743) has the molecular formula C14H16F2N2O4S
and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide.
Molecular Properties
| Compound Name | 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide |
| PubChem CID | 166541743 |
| Molecular Formula | C14H16F2N2O4S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide |
| SMILES | CS(=O)(=O)NC(=O)CC1CCC(=O)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C14H16F2N2O4S/c1-23(21,22)17-12(19)7-10-5-6-13(20)18(10)8-9-3-2-4-11(15)14(9)16/h2-4,10H,5-8H2,1H3,(H,17,19) |
| InChIKey | HEEAVRYACWXGAF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide?
The IUPAC name of 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide (CID 166541743) is 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide.
What is the SMILES notation for 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide?
The canonical SMILES for 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide is CS(=O)(=O)NC(=O)CC1CCC(=O)N1Cc1cccc(F)c1F.
What is the InChIKey of 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide?
The InChIKey is HEEAVRYACWXGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N2O4S/c1-23(21,22)17-12(19)7-10-5-6-13(20)18(10)8-9-3-2-4-11(15)14(9)16/h2-4,10H,5-8H2,1H3,(H,17,19).
What are the key properties of 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide?
2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide has a molecular weight of 346.36 g/mol, XLogP of 0.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2,3-difluorophenyl)methyl]-5-oxopyrrolidin-2-yl]-N-methylsulfonylacetamide is sourced from PubChem (CID 166541743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).