About 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline
8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline (PubChem CID 166541989) has the molecular formula C9H2BrCl2F3N2
and a molecular weight of 345.93 g/mol. Its IUPAC name is 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline.
Molecular Properties
| Compound Name | 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline |
| PubChem CID | 166541989 |
| Molecular Formula | C9H2BrCl2F3N2 |
| Molecular Weight | 345.93 g/mol |
| Exact Mass | 343.87 |
| IUPAC Name | 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline |
| SMILES | FC(F)(F)c1cc(Br)c2nc(Cl)nc(Cl)c2c1 |
| InChI | InChI=1S/C9H2BrCl2F3N2/c10-5-2-3(9(13,14)15)1-4-6(5)16-8(12)17-7(4)11/h1-2H |
| InChIKey | JKEQREKHVMWAAC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.93 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline?
The IUPAC name of 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline (CID 166541989) is 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline.
What is the SMILES notation for 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline?
The canonical SMILES for 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline is FC(F)(F)c1cc(Br)c2nc(Cl)nc(Cl)c2c1.
What is the InChIKey of 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline?
The InChIKey is JKEQREKHVMWAAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H2BrCl2F3N2/c10-5-2-3(9(13,14)15)1-4-6(5)16-8(12)17-7(4)11/h1-2H.
What are the key properties of 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline?
8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline has a molecular weight of 345.93 g/mol, XLogP of 4.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,4-dichloro-6-(trifluoromethyl)quinazoline is sourced from PubChem (CID 166541989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).