About 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+))
4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) (PubChem CID 166542400) has the molecular formula C6H5NRb2
and a molecular weight of 262.05 g/mol. Its IUPAC name is 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)).
Molecular Properties
| Compound Name | 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) |
| PubChem CID | 166542400 |
| Molecular Formula | C6H5NRb2 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 260.87 |
| IUPAC Name | 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) |
| SMILES | Cc1c[c-]n[c-]c1.[Rb+].[Rb+] |
| InChI | InChI=1S/C6H5N.2Rb/c1-6-2-4-7-5-3-6;;/h2-3H,1H3;;/q-2;2*+1 |
| InChIKey | QZPSLQDMGSFXHP-UHFFFAOYSA-N |
| XLogP | -5.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+))?
The IUPAC name of 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) (CID 166542400) is 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)).
What is the SMILES notation for 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+))?
The canonical SMILES for 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) is Cc1c[c-]n[c-]c1.[Rb+].[Rb+].
What is the InChIKey of 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+))?
The InChIKey is QZPSLQDMGSFXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N.2Rb/c1-6-2-4-7-5-3-6;;/h2-3H,1H3;;/q-2;2*+1.
What are the key properties of 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+))?
4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) has a molecular weight of 262.05 g/mol, XLogP of -5.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-dihydropyridine-2,6-diide;bis(rubidium(1+)) is sourced from PubChem (CID 166542400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).