C21H44N3O4P — CID 166542933
N,N-dimethyloxolan-3-amine;6-ethyl-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole;1-ethyl-4-methyl-1,4λ5-azaphosphinane 4-oxide (PubChem CID 166542933) has the molecular formula C21H44N3O4P and a molecular weight of 433.57 g/mol. Its IUPAC name is N,N-dimethyloxolan-3-amine;6-ethyl-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole;1-ethyl-4-methyl-1,4λ5-azaphosphinane 4-oxide.
| Compound Name | N,N-dimethyloxolan-3-amine;6-ethyl-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole;1-ethyl-4-methyl-1,4λ5-azaphosphinane 4-oxide |
|---|---|
| PubChem CID | 166542933 |
| Molecular Formula | C21H44N3O4P |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | N,N-dimethyloxolan-3-amine;6-ethyl-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole;1-ethyl-4-methyl-1,4λ5-azaphosphinane 4-oxide |
| SMILES | CCN1CC2OCCOC2C1.CCN1CCP(C)(=O)CC1.CN(C)C1CCOC1 |
| InChI | InChI=1S/C8H15NO2.C7H16NOP.C6H13NO/c1-2-9-5-7-8(6-9)11-4-3-10-7;1-3-8-4-6-10(2,9)7-5-8;1-7(2)6-3-4-8-5-6/h7-8H,2-6H2,1H3;3-7H2,1-2H3;6H,3-5H2,1-2H3 |
| InChIKey | FISPDGMOLWRMBE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|