C8H17NO2 — CID 166543360
4-ethyl-6-methoxy-1,4-oxazepane (PubChem CID 166543360) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 4-ethyl-6-methoxy-1,4-oxazepane.
| Compound Name | 4-ethyl-6-methoxy-1,4-oxazepane |
|---|---|
| PubChem CID | 166543360 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 4-ethyl-6-methoxy-1,4-oxazepane |
| SMILES | CCN1CCOCC(OC)C1 |
| InChI | InChI=1S/C8H17NO2/c1-3-9-4-5-11-7-8(6-9)10-2/h8H,3-7H2,1-2H3 |
| InChIKey | FTOZGEKNDVDGPJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |