C20H20BrN5O2 — CID 166544473
N-[2-[[4-[(2-bromo-3-phenylphenyl)methoxy]-1,3,5-triazin-2-yl]amino]ethyl]acetamide (PubChem CID 166544473) has the molecular formula C20H20BrN5O2 and a molecular weight of 442.32 g/mol. Its IUPAC name is N-[2-[[4-[(2-bromo-3-phenylphenyl)methoxy]-1,3,5-triazin-2-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[4-[(2-bromo-3-phenylphenyl)methoxy]-1,3,5-triazin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 166544473 |
| Molecular Formula | C20H20BrN5O2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[2-[[4-[(2-bromo-3-phenylphenyl)methoxy]-1,3,5-triazin-2-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ncnc(OCc2cccc(-c3ccccc3)c2Br)n1 |
| InChI | InChI=1S/C20H20BrN5O2/c1-14(27)22-10-11-23-19-24-13-25-20(26-19)28-12-16-8-5-9-17(18(16)21)15-6-3-2-4-7-15/h2-9,13H,10-12H2,1H3,(H,22,27)(H,23,24,25,26) |
| InChIKey | KJNQICVMJGIESP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|