About CID 166544678
CID 166544678 (PubChem CID 166544678) has the molecular formula C11H22N2O3Si
and a molecular weight of 258.39 g/mol.
Molecular Properties
| Compound Name | CID 166544678 |
| PubChem CID | 166544678 |
| Molecular Formula | C11H22N2O3Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | — |
| SMILES | CCCCC(CCN1CCNC1=O)[Si]C(O)O |
| InChI | InChI=1S/C11H22N2O3Si/c1-2-3-4-9(17-11(15)16)5-7-13-8-6-12-10(13)14/h9,11,15-16H,2-8H2,1H3,(H,12,14) |
| InChIKey | QDXNENCVZZHLRI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 166544678 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166544678?
The IUPAC name of CID 166544678 (CID 166544678) is not available.
What is the SMILES notation for CID 166544678?
The canonical SMILES for CID 166544678 is CCCCC(CCN1CCNC1=O)[Si]C(O)O.
What is the InChIKey of CID 166544678?
The InChIKey is QDXNENCVZZHLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3Si/c1-2-3-4-9(17-11(15)16)5-7-13-8-6-12-10(13)14/h9,11,15-16H,2-8H2,1H3,(H,12,14).
What are the key properties of CID 166544678?
CID 166544678 has a molecular weight of 258.39 g/mol, XLogP of 0.35, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166544678 is sourced from PubChem (CID 166544678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).