About CID 166544722
CID 166544722 (PubChem CID 166544722) has the molecular formula C9H18N2O3Si
and a molecular weight of 230.34 g/mol.
Molecular Properties
| Compound Name | CID 166544722 |
| PubChem CID | 166544722 |
| Molecular Formula | C9H18N2O3Si |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | — |
| SMILES | COC(OC)[Si]CCCN1CCNC1=O |
| InChI | InChI=1S/C9H18N2O3Si/c1-13-9(14-2)15-7-3-5-11-6-4-10-8(11)12/h9H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | NQTONZBKJMIGCH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 166544722 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166544722?
The IUPAC name of CID 166544722 (CID 166544722) is not available.
What is the SMILES notation for CID 166544722?
The canonical SMILES for CID 166544722 is COC(OC)[Si]CCCN1CCNC1=O.
What is the InChIKey of CID 166544722?
The InChIKey is NQTONZBKJMIGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3Si/c1-13-9(14-2)15-7-3-5-11-6-4-10-8(11)12/h9H,3-7H2,1-2H3,(H,10,12).
What are the key properties of CID 166544722?
CID 166544722 has a molecular weight of 230.34 g/mol, XLogP of 0.10, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166544722 is sourced from PubChem (CID 166544722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).