About 5-chloro-6-iodo-1,3-dihydro-2-benzofuran
5-chloro-6-iodo-1,3-dihydro-2-benzofuran (PubChem CID 166545060) has the molecular formula C8H6ClIO
and a molecular weight of 280.49 g/mol. Its IUPAC name is 5-chloro-6-iodo-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 5-chloro-6-iodo-1,3-dihydro-2-benzofuran |
| PubChem CID | 166545060 |
| Molecular Formula | C8H6ClIO |
| Molecular Weight | 280.49 g/mol |
| Exact Mass | 279.92 |
| IUPAC Name | 5-chloro-6-iodo-1,3-dihydro-2-benzofuran |
| SMILES | Clc1cc2c(cc1I)COC2 |
| InChI | InChI=1S/C8H6ClIO/c9-7-1-5-3-11-4-6(5)2-8(7)10/h1-2H,3-4H2 |
| InChIKey | WIZJYKWORXXOCL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6-iodo-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-iodo-1,3-dihydro-2-benzofuran?
The IUPAC name of 5-chloro-6-iodo-1,3-dihydro-2-benzofuran (CID 166545060) is 5-chloro-6-iodo-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 5-chloro-6-iodo-1,3-dihydro-2-benzofuran?
The canonical SMILES for 5-chloro-6-iodo-1,3-dihydro-2-benzofuran is Clc1cc2c(cc1I)COC2.
What is the InChIKey of 5-chloro-6-iodo-1,3-dihydro-2-benzofuran?
The InChIKey is WIZJYKWORXXOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClIO/c9-7-1-5-3-11-4-6(5)2-8(7)10/h1-2H,3-4H2.
What are the key properties of 5-chloro-6-iodo-1,3-dihydro-2-benzofuran?
5-chloro-6-iodo-1,3-dihydro-2-benzofuran has a molecular weight of 280.49 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-iodo-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 166545060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).