C13H12ClFN4O — CID 166545324
6-(4-amino-2-fluorophenoxy)-5-chloro-N-cyclopropylpyrimidin-4-amine (PubChem CID 166545324) has the molecular formula C13H12ClFN4O and a molecular weight of 294.72 g/mol. Its IUPAC name is 6-(4-amino-2-fluorophenoxy)-5-chloro-N-cyclopropylpyrimidin-4-amine.
| Compound Name | 6-(4-amino-2-fluorophenoxy)-5-chloro-N-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 166545324 |
| Molecular Formula | C13H12ClFN4O |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6-(4-amino-2-fluorophenoxy)-5-chloro-N-cyclopropylpyrimidin-4-amine |
| SMILES | Nc1ccc(Oc2ncnc(NC3CC3)c2Cl)c(F)c1 |
| InChI | InChI=1S/C13H12ClFN4O/c14-11-12(19-8-2-3-8)17-6-18-13(11)20-10-4-1-7(16)5-9(10)15/h1,4-6,8H,2-3,16H2,(H,17,18,19) |
| InChIKey | FUMCADZERBDMIM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|