C11H14N2O5 — CID 166546264
methyl 5-(2-ethoxy-2-oxoethyl)-2-methyl-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 166546264) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is methyl 5-(2-ethoxy-2-oxoethyl)-2-methyl-6-oxo-1H-pyrimidine-4-carboxylate.
| Compound Name | methyl 5-(2-ethoxy-2-oxoethyl)-2-methyl-6-oxo-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 166546264 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | methyl 5-(2-ethoxy-2-oxoethyl)-2-methyl-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OC)nc(C)[nH]c1=O |
| InChI | InChI=1S/C11H14N2O5/c1-4-18-8(14)5-7-9(11(16)17-3)12-6(2)13-10(7)15/h4-5H2,1-3H3,(H,12,13,15) |
| InChIKey | SSSRPTFERPSRIU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |