C15H8F5N3O2S — CID 16654628
1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-3-phenylpyrazol-5-amine (PubChem CID 16654628) has the molecular formula C15H8F5N3O2S and a molecular weight of 389.31 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-3-phenylpyrazol-5-amine.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-3-phenylpyrazol-5-amine |
|---|---|
| PubChem CID | 16654628 |
| Molecular Formula | C15H8F5N3O2S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)sulfonyl-3-phenylpyrazol-5-amine |
| SMILES | Nc1cc(-c2ccccc2)nn1S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8F5N3O2S/c16-10-11(17)13(19)15(14(20)12(10)18)26(24,25)23-9(21)6-8(22-23)7-4-2-1-3-5-7/h1-6H,21H2 |
| InChIKey | RRJFLYVIYFMOTE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|