About N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane
N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane (PubChem CID 166546503) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane.
Molecular Properties
| Compound Name | N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane |
| PubChem CID | 166546503 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane |
| SMILES | C=C/N=C/C1=C(C)CCN1.CC(C)C |
| InChI | InChI=1S/C8H12N2.C4H10/c1-3-9-6-8-7(2)4-5-10-8;1-4(2)3/h3,6,10H,1,4-5H2,2H3;4H,1-3H3/b9-6+; |
| InChIKey | GCYLQHVEKXHWAT-MLBSPLJJSA-N |
| XLogP | 3.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane?
The IUPAC name of N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane (CID 166546503) is N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane.
What is the SMILES notation for N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane?
The canonical SMILES for N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane is C=C/N=C/C1=C(C)CCN1.CC(C)C.
What is the InChIKey of N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane?
The InChIKey is GCYLQHVEKXHWAT-MLBSPLJJSA-N. The full InChI is InChI=1S/C8H12N2.C4H10/c1-3-9-6-8-7(2)4-5-10-8;1-4(2)3/h3,6,10H,1,4-5H2,2H3;4H,1-3H3/b9-6+;.
What are the key properties of N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane?
N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane has a molecular weight of 194.32 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-1-(4-methyl-2,3-dihydro-1H-pyrrol-5-yl)methanimine;2-methylpropane is sourced from PubChem (CID 166546503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).