C16H18ClF2N3O — CID 166546607
6-chloro-1-[(2R,3S)-3-(difluoromethoxy)-2-methylazetidin-1-yl]-4-propan-2-yl-2,7-naphthyridine (PubChem CID 166546607) has the molecular formula C16H18ClF2N3O and a molecular weight of 341.79 g/mol. Its IUPAC name is 6-chloro-1-[(2R,3S)-3-(difluoromethoxy)-2-methylazetidin-1-yl]-4-propan-2-yl-2,7-naphthyridine.
| Compound Name | 6-chloro-1-[(2R,3S)-3-(difluoromethoxy)-2-methylazetidin-1-yl]-4-propan-2-yl-2,7-naphthyridine |
|---|---|
| PubChem CID | 166546607 |
| Molecular Formula | C16H18ClF2N3O |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 6-chloro-1-[(2R,3S)-3-(difluoromethoxy)-2-methylazetidin-1-yl]-4-propan-2-yl-2,7-naphthyridine |
| SMILES | CC(C)c1cnc(N2C[C@H](OC(F)F)[C@H]2C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H18ClF2N3O/c1-8(2)11-5-21-15(12-6-20-14(17)4-10(11)12)22-7-13(9(22)3)23-16(18)19/h4-6,8-9,13,16H,7H2,1-3H3/t9-,13+/m1/s1 |
| InChIKey | XBHLMPPTLVPISA-RNCFNFMXSA-N |
| XLogP | 4.22 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|