C15H15ClFN3O — CID 166546811
2-[6-chloro-1-[(2R,3R)-3-fluoro-2-methylazetidin-1-yl]-2,7-naphthyridin-4-yl]prop-2-en-1-ol (PubChem CID 166546811) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-[6-chloro-1-[(2R,3R)-3-fluoro-2-methylazetidin-1-yl]-2,7-naphthyridin-4-yl]prop-2-en-1-ol.
| Compound Name | 2-[6-chloro-1-[(2R,3R)-3-fluoro-2-methylazetidin-1-yl]-2,7-naphthyridin-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 166546811 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[6-chloro-1-[(2R,3R)-3-fluoro-2-methylazetidin-1-yl]-2,7-naphthyridin-4-yl]prop-2-en-1-ol |
| SMILES | C=C(CO)c1cnc(N2C[C@@H](F)[C@H]2C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C15H15ClFN3O/c1-8(7-21)11-4-19-15(20-6-13(17)9(20)2)12-5-18-14(16)3-10(11)12/h3-5,9,13,21H,1,6-7H2,2H3/t9-,13-/m1/s1 |
| InChIKey | UGCFUQUOYUPUFE-NOZJJQNGSA-N |
| XLogP | 2.84 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|