About 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine
6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine (PubChem CID 166546892) has the molecular formula C15H16ClF2N3
and a molecular weight of 311.76 g/mol. Its IUPAC name is 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine.
Molecular Properties
| Compound Name | 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine |
| PubChem CID | 166546892 |
| Molecular Formula | C15H16ClF2N3 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine |
| SMILES | CC(C)c1cnc(N2CCC(F)(F)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C15H16ClF2N3/c1-9(2)11-6-20-14(21-4-3-15(17,18)8-21)12-7-19-13(16)5-10(11)12/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | WJOHGAUWGQZYHZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine?
The IUPAC name of 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine (CID 166546892) is 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine.
What is the SMILES notation for 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine?
The canonical SMILES for 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine is CC(C)c1cnc(N2CCC(F)(F)C2)c2cnc(Cl)cc12.
What is the InChIKey of 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine?
The InChIKey is WJOHGAUWGQZYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClF2N3/c1-9(2)11-6-20-14(21-4-3-15(17,18)8-21)12-7-19-13(16)5-10(11)12/h5-7,9H,3-4,8H2,1-2H3.
What are the key properties of 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine?
6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine has a molecular weight of 311.76 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-(3,3-difluoropyrrolidin-1-yl)-4-propan-2-yl-2,7-naphthyridine is sourced from PubChem (CID 166546892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).