C11H15N2Re- — CID 166547546
1-propan-2-yl-2,3,4,5-tetrahydro-1,7-naphthyridin-5-ide;rhenium (PubChem CID 166547546) has the molecular formula C11H15N2Re- and a molecular weight of 361.46 g/mol. Its IUPAC name is 1-propan-2-yl-2,3,4,5-tetrahydro-1,7-naphthyridin-5-ide;rhenium.
| Compound Name | 1-propan-2-yl-2,3,4,5-tetrahydro-1,7-naphthyridin-5-ide;rhenium |
|---|---|
| PubChem CID | 166547546 |
| Molecular Formula | C11H15N2Re- |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 1-propan-2-yl-2,3,4,5-tetrahydro-1,7-naphthyridin-5-ide;rhenium |
| SMILES | CC(C)N1CCCc2[c-]cncc21.[Re] |
| InChI | InChI=1S/C11H15N2.Re/c1-9(2)13-7-3-4-10-5-6-12-8-11(10)13;/h6,8-9H,3-4,7H2,1-2H3;/q-1; |
| InChIKey | UQORXHARKZSCOP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|