C24H21FN6 — CID 166547565
8-[6-(2-cyclopropylethynyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-10-fluoro-3-methyl-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 166547565) has the molecular formula C24H21FN6 and a molecular weight of 412.47 g/mol. Its IUPAC name is 8-[6-(2-cyclopropylethynyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-10-fluoro-3-methyl-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 8-[6-(2-cyclopropylethynyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-10-fluoro-3-methyl-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 166547565 |
| Molecular Formula | C24H21FN6 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 8-[6-(2-cyclopropylethynyl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-10-fluoro-3-methyl-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | Cc1nnc2nc(N3CCCCc4c(C#CC5CC5)cccc43)c3c(F)cncc3n12 |
| InChI | InChI=1S/C24H21FN6/c1-15-28-29-24-27-23(22-19(25)13-26-14-21(22)31(15)24)30-12-3-2-6-18-17(5-4-7-20(18)30)11-10-16-8-9-16/h4-5,7,13-14,16H,2-3,6,8-9,12H2,1H3 |
| InChIKey | DJIASFGOLMFSNN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|