C23H17F4N7 — CID 166547569
10-fluoro-3-methyl-8-[5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-1,6-naphthyridin-1-yl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 166547569) has the molecular formula C23H17F4N7 and a molecular weight of 467.43 g/mol. Its IUPAC name is 10-fluoro-3-methyl-8-[5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-1,6-naphthyridin-1-yl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 10-fluoro-3-methyl-8-[5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-1,6-naphthyridin-1-yl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 166547569 |
| Molecular Formula | C23H17F4N7 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 10-fluoro-3-methyl-8-[5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-3,4-dihydro-2H-1,6-naphthyridin-1-yl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | Cc1nnc2nc(N3CCCc4c3ccnc4C#CC3(C(F)(F)F)CC3)c3c(F)cncc3n12 |
| InChI | InChI=1S/C23H17F4N7/c1-13-31-32-21-30-20(19-15(24)11-28-12-18(19)34(13)21)33-10-2-3-14-16(29-9-5-17(14)33)4-6-22(7-8-22)23(25,26)27/h5,9,11-12H,2-3,7-8,10H2,1H3 |
| InChIKey | LZPXJMRRVAXJKS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|