C21H13F6N7 — CID 166547779
N-(2,2-difluoroethyl)-10-fluoro-N-[2-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-4-pyridinyl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-8-amine (PubChem CID 166547779) has the molecular formula C21H13F6N7 and a molecular weight of 477.37 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-10-fluoro-N-[2-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-4-pyridinyl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-8-amine.
| Compound Name | N-(2,2-difluoroethyl)-10-fluoro-N-[2-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-4-pyridinyl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-8-amine |
|---|---|
| PubChem CID | 166547779 |
| Molecular Formula | C21H13F6N7 |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-10-fluoro-N-[2-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]-4-pyridinyl]-2,4,5,7,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-8-amine |
| SMILES | Fc1cncc2c1c(N(CC(F)F)c1ccnc(C#CC3(C(F)(F)F)CC3)c1)nc1nncn12 |
| InChI | InChI=1S/C21H13F6N7/c22-14-8-28-9-15-17(14)18(31-19-32-30-11-34(15)19)33(10-16(23)24)13-2-6-29-12(7-13)1-3-20(4-5-20)21(25,26)27/h2,6-9,11,16H,4-5,10H2 |
| InChIKey | PAXVNRYSOIWZKD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|