C23H19F7N6 — CID 166547883
4-[amino(methyl)amino]-1-N-(2,2-difluoroethyl)-8-fluoro-1-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-2,6-naphthyridine-1,3-diamine (PubChem CID 166547883) has the molecular formula C23H19F7N6 and a molecular weight of 512.43 g/mol. Its IUPAC name is 4-[amino(methyl)amino]-1-N-(2,2-difluoroethyl)-8-fluoro-1-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-2,6-naphthyridine-1,3-diamine.
| Compound Name | 4-[amino(methyl)amino]-1-N-(2,2-difluoroethyl)-8-fluoro-1-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-2,6-naphthyridine-1,3-diamine |
|---|---|
| PubChem CID | 166547883 |
| Molecular Formula | C23H19F7N6 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-[amino(methyl)amino]-1-N-(2,2-difluoroethyl)-8-fluoro-1-N-[3-fluoro-5-[2-[1-(trifluoromethyl)cyclopropyl]ethynyl]phenyl]-2,6-naphthyridine-1,3-diamine |
| SMILES | CN(N)c1c(N)nc(N(CC(F)F)c2cc(F)cc(C#CC3(C(F)(F)F)CC3)c2)c2c(F)cncc12 |
| InChI | InChI=1S/C23H19F7N6/c1-35(32)19-15-9-33-10-16(25)18(15)21(34-20(19)31)36(11-17(26)27)14-7-12(6-13(24)8-14)2-3-22(4-5-22)23(28,29)30/h6-10,17H,4-5,11,32H2,1H3,(H2,31,34) |
| InChIKey | DOFRWJORCPGVHH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|