C18H22N2 — CID 166547958
1-[6-[2-(1-methylcyclopropyl)ethynyl]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanimine (PubChem CID 166547958) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-[6-[2-(1-methylcyclopropyl)ethynyl]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanimine.
| Compound Name | 1-[6-[2-(1-methylcyclopropyl)ethynyl]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanimine |
|---|---|
| PubChem CID | 166547958 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-[6-[2-(1-methylcyclopropyl)ethynyl]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)N1CCCCc2c(C#CC3(C)CC3)cccc21 |
| InChI | InChI=1S/C18H22N2/c1-14(19)20-13-4-3-7-16-15(6-5-8-17(16)20)9-10-18(2)11-12-18/h5-6,8,19H,3-4,7,11-13H2,1-2H3/b19-14+ |
| InChIKey | JVUJPHGZBSWNIA-XMHGGMMESA-N |
| XLogP | 3.98 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|