C20H19BrClFN2 — CID 166548162
(E)-1-(6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-N-(1-chloroethenyl)-1-(2-fluoro-6-methylphenyl)methanimine (PubChem CID 166548162) has the molecular formula C20H19BrClFN2 and a molecular weight of 421.74 g/mol. Its IUPAC name is (E)-1-(6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-N-(1-chloroethenyl)-1-(2-fluoro-6-methylphenyl)methanimine.
| Compound Name | (E)-1-(6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-N-(1-chloroethenyl)-1-(2-fluoro-6-methylphenyl)methanimine |
|---|---|
| PubChem CID | 166548162 |
| Molecular Formula | C20H19BrClFN2 |
| Molecular Weight | 421.74 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | (E)-1-(6-bromo-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-N-(1-chloroethenyl)-1-(2-fluoro-6-methylphenyl)methanimine |
| SMILES | C=C(Cl)/N=C(\c1c(C)cccc1F)N1CCCCc2c(Br)cccc21 |
| InChI | InChI=1S/C20H19BrClFN2/c1-13-7-5-10-17(23)19(13)20(24-14(2)22)25-12-4-3-8-15-16(21)9-6-11-18(15)25/h5-7,9-11H,2-4,8,12H2,1H3/b24-20+ |
| InChIKey | JGSBOIOKLQFYFC-HIXSDJFHSA-N |
| XLogP | 6.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.74 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|