C14H21F2NO — CID 166548312
1-(1,1-difluoroethyl)-N-(2,5-dimethylhex-3-yn-2-yl)cyclopropane-1-carboxamide (PubChem CID 166548312) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-N-(2,5-dimethylhex-3-yn-2-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-(1,1-difluoroethyl)-N-(2,5-dimethylhex-3-yn-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166548312 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(1,1-difluoroethyl)-N-(2,5-dimethylhex-3-yn-2-yl)cyclopropane-1-carboxamide |
| SMILES | CC(C)C#CC(C)(C)NC(=O)C1(C(C)(F)F)CC1 |
| InChI | InChI=1S/C14H21F2NO/c1-10(2)6-7-12(3,4)17-11(18)14(8-9-14)13(5,15)16/h10H,8-9H2,1-5H3,(H,17,18) |
| InChIKey | BGZHTGOODZBANM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|