C7H13N3 — CID 166548505
5-(methyliminomethyl)-1,2,3,6-tetrahydropyridin-4-amine (PubChem CID 166548505) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-(methyliminomethyl)-1,2,3,6-tetrahydropyridin-4-amine.
| Compound Name | 5-(methyliminomethyl)-1,2,3,6-tetrahydropyridin-4-amine |
|---|---|
| PubChem CID | 166548505 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 5-(methyliminomethyl)-1,2,3,6-tetrahydropyridin-4-amine |
| SMILES | C/N=C/C1=C(N)CCNC1 |
| InChI | InChI=1S/C7H13N3/c1-9-4-6-5-10-3-2-7(6)8/h4,10H,2-3,5,8H2,1H3/b9-4+ |
| InChIKey | KFWKHTAUFXYHFK-RUDMXATFSA-N |
| XLogP | -0.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|