C18H18N4O3 — CID 16654900
(3aR,7aS)-2-[5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 16654900) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is (3aR,7aS)-2-[5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 16654900 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3aR,7aS)-2-[5-[(4-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1ccc(Cc2nc(N3C(=O)[C@H]4CC=CC[C@H]4C3=O)n[nH]2)cc1 |
| InChI | InChI=1S/C18H18N4O3/c1-25-12-8-6-11(7-9-12)10-15-19-18(21-20-15)22-16(23)13-4-2-3-5-14(13)17(22)24/h2-3,6-9,13-14H,4-5,10H2,1H3,(H,19,20,21)/t13-,14+ |
| InChIKey | VNXQRDLYOJREOX-OKILXGFUSA-N |
| XLogP | 1.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|