C25H22F4N6 — CID 166549274
4-[6-[2-[1-(difluoromethyl)cyclopropyl]ethynyl]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl]-1-ethanimidoyl-5,6-difluoroquinazolin-2-imine (PubChem CID 166549274) has the molecular formula C25H22F4N6 and a molecular weight of 482.49 g/mol. Its IUPAC name is 4-[6-[2-[1-(difluoromethyl)cyclopropyl]ethynyl]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl]-1-ethanimidoyl-5,6-difluoroquinazolin-2-imine.
| Compound Name | 4-[6-[2-[1-(difluoromethyl)cyclopropyl]ethynyl]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl]-1-ethanimidoyl-5,6-difluoroquinazolin-2-imine |
|---|---|
| PubChem CID | 166549274 |
| Molecular Formula | C25H22F4N6 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 4-[6-[2-[1-(difluoromethyl)cyclopropyl]ethynyl]-2,3,4,5-tetrahydropyrido[3,4-b]azepin-1-yl]-1-ethanimidoyl-5,6-difluoroquinazolin-2-imine |
| SMILES | [H]/N=C(\C)n1/c(=N/[H])nc(N2CCCCc3c(C#CC4(C(F)F)CC4)cncc32)c2c(F)c(F)ccc21 |
| InChI | InChI=1S/C25H22F4N6/c1-14(30)35-18-6-5-17(26)21(27)20(18)22(33-24(35)31)34-11-3-2-4-16-15(12-32-13-19(16)34)7-8-25(9-10-25)23(28)29/h5-6,12-13,23,30-31H,2-4,9-11H2,1H3/b30-14+,31-24+ |
| InChIKey | AYJBDRXAUOYBKJ-ITAPNGCNSA-N |
| XLogP | 4.91 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|