About 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine
2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 16654934) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine |
| PubChem CID | 16654934 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | O=[N+]([O-])c1cccc(C2=NCCC(c3ccccc3)O2)c1 |
| InChI | InChI=1S/C16H14N2O3/c19-18(20)14-8-4-7-13(11-14)16-17-10-9-15(21-16)12-5-2-1-3-6-12/h1-8,11,15H,9-10H2 |
| InChIKey | RZMRPHRFKNFRHE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine?
The IUPAC name of 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine (CID 16654934) is 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine.
What is the SMILES notation for 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine?
The canonical SMILES for 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine is O=[N+]([O-])c1cccc(C2=NCCC(c3ccccc3)O2)c1.
What is the InChIKey of 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine?
The InChIKey is RZMRPHRFKNFRHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c19-18(20)14-8-4-7-13(11-14)16-17-10-9-15(21-16)12-5-2-1-3-6-12/h1-8,11,15H,9-10H2.
What are the key properties of 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine?
2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine has a molecular weight of 282.30 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitrophenyl)-6-phenyl-5,6-dihydro-4H-1,3-oxazine is sourced from PubChem (CID 16654934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).