C18H14BBrFN6 — CID 166549351
CID 166549351 (PubChem CID 166549351) has the molecular formula C18H14BBrFN6 and a molecular weight of 424.07 g/mol.
| Compound Name | CID 166549351 |
|---|---|
| PubChem CID | 166549351 |
| Molecular Formula | C18H14BBrFN6 |
| Molecular Weight | 424.07 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | — |
| SMILES | Cc1nnc2nc(N3CC[B]Cc4c3ccnc4Br)c3cc(F)ccc3n12 |
| InChI | InChI=1S/C18H14BBrFN6/c1-10-24-25-18-23-17(12-8-11(21)2-3-15(12)27(10)18)26-7-5-19-9-13-14(26)4-6-22-16(13)20/h2-4,6,8H,5,7,9H2,1H3 |
| InChIKey | ITQFVNRRUNESJW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.07 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|