C28H26F2N6O2 — CID 166549356
prop-1-en-2-yl 4-[1-(6,7-difluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2,2-dimethylbut-3-ynimidate (PubChem CID 166549356) has the molecular formula C28H26F2N6O2 and a molecular weight of 516.55 g/mol. Its IUPAC name is prop-1-en-2-yl 4-[1-(6,7-difluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2,2-dimethylbut-3-ynimidate.
| Compound Name | prop-1-en-2-yl 4-[1-(6,7-difluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2,2-dimethylbut-3-ynimidate |
|---|---|
| PubChem CID | 166549356 |
| Molecular Formula | C28H26F2N6O2 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | prop-1-en-2-yl 4-[1-(6,7-difluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2,2-dimethylbut-3-ynimidate |
| SMILES | [H]/N=C(\OC(=C)C)C(C)(C)C#Cc1cccc2c1COCCN2c1nc2nnc(C)n2c2ccc(F)c(F)c12 |
| InChI | InChI=1S/C28H26F2N6O2/c1-16(2)38-26(31)28(4,5)12-11-18-7-6-8-21-19(18)15-37-14-13-35(21)25-23-22(10-9-20(29)24(23)30)36-17(3)33-34-27(36)32-25/h6-10,31H,1,13-15H2,2-5H3/b31-26- |
| InChIKey | KZXLJZIIMYGVIM-ZXPTYKNPSA-N |
| XLogP | 5.44 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|