C15H17F2NO — CID 166549434
6-(4,4-difluoro-3,3-dimethylbut-1-ynyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine (PubChem CID 166549434) has the molecular formula C15H17F2NO and a molecular weight of 265.30 g/mol. Its IUPAC name is 6-(4,4-difluoro-3,3-dimethylbut-1-ynyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine.
| Compound Name | 6-(4,4-difluoro-3,3-dimethylbut-1-ynyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine |
|---|---|
| PubChem CID | 166549434 |
| Molecular Formula | C15H17F2NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-(4,4-difluoro-3,3-dimethylbut-1-ynyl)-1,2,3,5-tetrahydro-4,1-benzoxazepine |
| SMILES | CC(C)(C#Cc1cccc2c1COCCN2)C(F)F |
| InChI | InChI=1S/C15H17F2NO/c1-15(2,14(16)17)7-6-11-4-3-5-13-12(11)10-19-9-8-18-13/h3-5,14,18H,8-10H2,1-2H3 |
| InChIKey | OTZWXRWOKVZPPT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|