About 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane
1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane (PubChem CID 166549694) has the molecular formula C29H28BrN3O3
and a molecular weight of 546.47 g/mol. Its IUPAC name is 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane.
Molecular Properties
| Compound Name | 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane |
| PubChem CID | 166549694 |
| Molecular Formula | C29H28BrN3O3 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane |
| SMILES | CC.Cn1c(=O)n(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C27H22BrN3O3.C2H6/c1-30-24-16-21(28)12-13-22(24)31(27(30)32)23-14-15-25(33-17-19-8-4-2-5-9-19)29-26(23)34-18-20-10-6-3-7-11-20;1-2/h2-16H,17-18H2,1H3;1-2H3 |
| InChIKey | FSWGVXISPZVVDC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane?
The IUPAC name of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane (CID 166549694) is 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane.
What is the SMILES notation for 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane?
The canonical SMILES for 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane is CC.Cn1c(=O)n(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2ccc(Br)cc21.
What is the InChIKey of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane?
The InChIKey is FSWGVXISPZVVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22BrN3O3.C2H6/c1-30-24-16-21(28)12-13-22(24)31(27(30)32)23-14-15-25(33-17-19-8-4-2-5-9-19)29-26(23)34-18-20-10-6-3-7-11-20;1-2/h2-16H,17-18H2,1H3;1-2H3.
What are the key properties of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane?
1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane has a molecular weight of 546.47 g/mol, XLogP of 6.67, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-5-bromo-3-methylbenzimidazol-2-one;ethane is sourced from PubChem (CID 166549694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).