C15H12Cl3F3N4 — CID 16654991
6-amino-N'-methyl-5-(2,3,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboximidamide (PubChem CID 16654991) has the molecular formula C15H12Cl3F3N4 and a molecular weight of 411.64 g/mol. Its IUPAC name is 6-amino-N'-methyl-5-(2,3,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboximidamide.
| Compound Name | 6-amino-N'-methyl-5-(2,3,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 16654991 |
| Molecular Formula | C15H12Cl3F3N4 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 6-amino-N'-methyl-5-(2,3,5-trichlorophenyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboximidamide |
| SMILES | C/N=C(\NCC(F)(F)F)c1ccc(-c2cc(Cl)cc(Cl)c2Cl)c(N)n1 |
| InChI | InChI=1S/C15H12Cl3F3N4/c1-23-14(24-6-15(19,20)21)11-3-2-8(13(22)25-11)9-4-7(16)5-10(17)12(9)18/h2-5H,6H2,1H3,(H2,22,25)(H,23,24) |
| InChIKey | UDRLSJMFEZIRDP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|