C25H33N7O2 — CID 166549981
N-(2-methoxyethyl)-6-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]-4-propan-2-yl-2,7-naphthyridine-1-carboxamide (PubChem CID 166549981) has the molecular formula C25H33N7O2 and a molecular weight of 463.59 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]-4-propan-2-yl-2,7-naphthyridine-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-6-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]-4-propan-2-yl-2,7-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 166549981 |
| Molecular Formula | C25H33N7O2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | N-(2-methoxyethyl)-6-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]amino]-4-propan-2-yl-2,7-naphthyridine-1-carboxamide |
| SMILES | COCCNC(=O)c1ncc(C(C)C)c2cc(Nc3ccnc(N4CCCC(C)C4)n3)ncc12 |
| InChI | InChI=1S/C25H33N7O2/c1-16(2)19-13-29-23(24(33)26-9-11-34-4)20-14-28-22(12-18(19)20)30-21-7-8-27-25(31-21)32-10-5-6-17(3)15-32/h7-8,12-14,16-17H,5-6,9-11,15H2,1-4H3,(H,26,33)(H,27,28,30,31) |
| InChIKey | MTELXVOSGZDXGY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|