About 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide
3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide (PubChem CID 16655010) has the molecular formula C17H9BrCl2F2N4O2
and a molecular weight of 490.09 g/mol. Its IUPAC name is 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide |
| PubChem CID | 16655010 |
| Molecular Formula | C17H9BrCl2F2N4O2 |
| Molecular Weight | 490.09 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide |
| SMILES | NC(=O)c1cc(Cl)cc(Cl)c1NC(=O)c1cc(Br)nn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C17H9BrCl2F2N4O2/c18-14-6-13(26(25-14)12-2-1-8(21)5-11(12)22)17(28)24-15-9(16(23)27)3-7(19)4-10(15)20/h1-6H,(H2,23,27)(H,24,28) |
| InChIKey | VUVSYDKRFOUZQZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.09 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide?
The IUPAC name of 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide (CID 16655010) is 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide.
What is the SMILES notation for 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide?
The canonical SMILES for 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide is NC(=O)c1cc(Cl)cc(Cl)c1NC(=O)c1cc(Br)nn1-c1ccc(F)cc1F.
What is the InChIKey of 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide?
The InChIKey is VUVSYDKRFOUZQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9BrCl2F2N4O2/c18-14-6-13(26(25-14)12-2-1-8(21)5-11(12)22)17(28)24-15-9(16(23)27)3-7(19)4-10(15)20/h1-6H,(H2,23,27)(H,24,28).
What are the key properties of 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide?
3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide has a molecular weight of 490.09 g/mol, XLogP of 4.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(2-carbamoyl-4,6-dichlorophenyl)-1-(2,4-difluorophenyl)pyrazole-5-carboxamide is sourced from PubChem (CID 16655010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).