About 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide
3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide (PubChem CID 16655141) has the molecular formula C18H17N3O3S
and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide |
| PubChem CID | 16655141 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide |
| SMILES | NC(=O)c1oc2c(sc3cc(OCCCn4cccc4)ccc32)c1N |
| InChI | InChI=1S/C18H17N3O3S/c19-14-16(18(20)22)24-15-12-5-4-11(10-13(12)25-17(14)15)23-9-3-8-21-6-1-2-7-21/h1-2,4-7,10H,3,8-9,19H2,(H2,20,22) |
| InChIKey | MIUSNILGBNIVJR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide?
The IUPAC name of 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide (CID 16655141) is 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide.
What is the SMILES notation for 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide?
The canonical SMILES for 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide is NC(=O)c1oc2c(sc3cc(OCCCn4cccc4)ccc32)c1N.
What is the InChIKey of 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide?
The InChIKey is MIUSNILGBNIVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O3S/c19-14-16(18(20)22)24-15-12-5-4-11(10-13(12)25-17(14)15)23-9-3-8-21-6-1-2-7-21/h1-2,4-7,10H,3,8-9,19H2,(H2,20,22).
What are the key properties of 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide?
3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide has a molecular weight of 355.42 g/mol, XLogP of 3.60, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-(3-pyrrol-1-ylpropoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide is sourced from PubChem (CID 16655141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).