C16H22N6O — CID 166552088
1-[3-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)prop-2-ynyl]-3-propylurea (PubChem CID 166552088) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[3-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)prop-2-ynyl]-3-propylurea.
| Compound Name | 1-[3-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)prop-2-ynyl]-3-propylurea |
|---|---|
| PubChem CID | 166552088 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-[3-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)prop-2-ynyl]-3-propylurea |
| SMILES | CCCNC(=O)NCC#Cc1cn(C(C)C)c2ncnc(N)c12 |
| InChI | InChI=1S/C16H22N6O/c1-4-7-18-16(23)19-8-5-6-12-9-22(11(2)3)15-13(12)14(17)20-10-21-15/h9-11H,4,7-8H2,1-3H3,(H2,17,20,21)(H2,18,19,23) |
| InChIKey | SEBNQRAUPOITRU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|