C20H28O5 — CID 16655229
(1S,2S,5R,6R,8S,9R,10S,11R)-9,10-dihydroxy-6,12,12-trimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,15-dione (PubChem CID 16655229) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,2S,5R,6R,8S,9R,10S,11R)-9,10-dihydroxy-6,12,12-trimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,15-dione.
| Compound Name | (1S,2S,5R,6R,8S,9R,10S,11R)-9,10-dihydroxy-6,12,12-trimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,15-dione |
|---|---|
| PubChem CID | 16655229 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,2S,5R,6R,8S,9R,10S,11R)-9,10-dihydroxy-6,12,12-trimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,15-dione |
| SMILES | C[C@H]1C(=O)[C@]23C[C@H]1CC[C@H]2[C@@]12CO[C@@]3(O)[C@@H](O)[C@@H]1C(C)(C)CCC2=O |
| InChI | InChI=1S/C20H28O5/c1-10-11-4-5-12-18-9-25-20(24,19(12,8-11)15(10)22)16(23)14(18)17(2,3)7-6-13(18)21/h10-12,14,16,23-24H,4-9H2,1-3H3/t10-,11-,12+,14-,16+,18-,19+,20+/m1/s1 |
| InChIKey | JCEZAGVDWVAALC-MWMHZQLVSA-N |
| XLogP | 1.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |