About 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane
7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane (PubChem CID 166552962) has the molecular formula C20H34N2O2
and a molecular weight of 334.50 g/mol. Its IUPAC name is 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane |
| PubChem CID | 166552962 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane |
| SMILES | CC(C)C1=CNC2(C=C1)COC2.CC(C)C1CCC2(COC2)NC1 |
| InChI | InChI=1S/C10H19NO.C10H15NO/c2*1-8(2)9-3-4-10(11-5-9)6-12-7-10/h8-9,11H,3-7H2,1-2H3;3-5,8,11H,6-7H2,1-2H3 |
| InChIKey | UWWBZCCDAWNDOI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane?
The IUPAC name of 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane (CID 166552962) is 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane.
What is the SMILES notation for 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane?
The canonical SMILES for 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane is CC(C)C1=CNC2(C=C1)COC2.CC(C)C1CCC2(COC2)NC1.
What is the InChIKey of 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane?
The InChIKey is UWWBZCCDAWNDOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.C10H15NO/c2*1-8(2)9-3-4-10(11-5-9)6-12-7-10/h8-9,11H,3-7H2,1-2H3;3-5,8,11H,6-7H2,1-2H3.
What are the key properties of 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane?
7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane has a molecular weight of 334.50 g/mol, XLogP of 2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yl-2-oxa-5-azaspiro[3.5]nona-6,8-diene;7-propan-2-yl-2-oxa-5-azaspiro[3.5]nonane is sourced from PubChem (CID 166552962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).