C11H16FN — CID 166553100
6-fluoro-2-propan-2-yl-1,3,4,5-tetrahydroisoindole (PubChem CID 166553100) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 6-fluoro-2-propan-2-yl-1,3,4,5-tetrahydroisoindole.
| Compound Name | 6-fluoro-2-propan-2-yl-1,3,4,5-tetrahydroisoindole |
|---|---|
| PubChem CID | 166553100 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 6-fluoro-2-propan-2-yl-1,3,4,5-tetrahydroisoindole |
| SMILES | CC(C)N1CC2=C(CCC(F)=C2)C1 |
| InChI | InChI=1S/C11H16FN/c1-8(2)13-6-9-3-4-11(12)5-10(9)7-13/h5,8H,3-4,6-7H2,1-2H3 |
| InChIKey | KBTLQNYMEBNXDK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |