About 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde
9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde (PubChem CID 166553337) has the molecular formula C15H20ClNO2
and a molecular weight of 281.78 g/mol. Its IUPAC name is 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde.
Molecular Properties
| Compound Name | 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde |
| PubChem CID | 166553337 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde |
| SMILES | Cc1cc(Cl)c2c(c1)CN(CC(C)C)C(C=O)CO2 |
| InChI | InChI=1S/C15H20ClNO2/c1-10(2)6-17-7-12-4-11(3)5-14(16)15(12)19-9-13(17)8-18/h4-5,8,10,13H,6-7,9H2,1-3H3 |
| InChIKey | VXRBBONGYHATMG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde?
The IUPAC name of 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde (CID 166553337) is 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde.
What is the SMILES notation for 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde?
The canonical SMILES for 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde is Cc1cc(Cl)c2c(c1)CN(CC(C)C)C(C=O)CO2.
What is the InChIKey of 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde?
The InChIKey is VXRBBONGYHATMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClNO2/c1-10(2)6-17-7-12-4-11(3)5-14(16)15(12)19-9-13(17)8-18/h4-5,8,10,13H,6-7,9H2,1-3H3.
What are the key properties of 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde?
9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde has a molecular weight of 281.78 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-7-methyl-4-(2-methylpropyl)-3,5-dihydro-2H-1,4-benzoxazepine-3-carbaldehyde is sourced from PubChem (CID 166553337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).