About 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid
3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid (PubChem CID 166554838) has the molecular formula C24H29Br2N3O4
and a molecular weight of 583.32 g/mol. Its IUPAC name is 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid |
| PubChem CID | 166554838 |
| Molecular Formula | C24H29Br2N3O4 |
| Molecular Weight | 583.32 g/mol |
| Exact Mass | 581.05 |
| IUPAC Name | 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCN1CCN(CC(O)Cn2c3ccc(Br)cc3c3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C24H29Br2N3O4/c25-17-1-3-22-20(13-17)21-14-18(26)2-4-23(21)29(22)16-19(30)15-28-8-6-27(7-9-28)10-12-33-11-5-24(31)32/h1-4,13-14,19,30H,5-12,15-16H2,(H,31,32) |
| InChIKey | VSTPMZYZEQYWEL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 583.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid?
The IUPAC name of 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid (CID 166554838) is 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid.
What is the SMILES notation for 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid?
The canonical SMILES for 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid is O=C(O)CCOCCN1CCN(CC(O)Cn2c3ccc(Br)cc3c3cc(Br)ccc32)CC1.
What is the InChIKey of 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid?
The InChIKey is VSTPMZYZEQYWEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29Br2N3O4/c25-17-1-3-22-20(13-17)21-14-18(26)2-4-23(21)29(22)16-19(30)15-28-8-6-27(7-9-28)10-12-33-11-5-24(31)32/h1-4,13-14,19,30H,5-12,15-16H2,(H,31,32).
What are the key properties of 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid?
3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid has a molecular weight of 583.32 g/mol, XLogP of 3.79, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[4-[3-(3,6-dibromocarbazol-9-yl)-2-hydroxypropyl]piperazin-1-yl]ethoxy]propanoic acid is sourced from PubChem (CID 166554838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).