C32H32Cl2N6S — CID 16655491
2-(4-methylphenyl)-1-[4-[5-[4-[[N'-(4-methylphenyl)carbamimidoyl]amino]phenyl]thiophen-2-yl]phenyl]guanidine;dihydrochloride (PubChem CID 16655491) has the molecular formula C32H32Cl2N6S and a molecular weight of 603.62 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1-[4-[5-[4-[[N'-(4-methylphenyl)carbamimidoyl]amino]phenyl]thiophen-2-yl]phenyl]guanidine;dihydrochloride.
| Compound Name | 2-(4-methylphenyl)-1-[4-[5-[4-[[N'-(4-methylphenyl)carbamimidoyl]amino]phenyl]thiophen-2-yl]phenyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 16655491 |
| Molecular Formula | C32H32Cl2N6S |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 2-(4-methylphenyl)-1-[4-[5-[4-[[N'-(4-methylphenyl)carbamimidoyl]amino]phenyl]thiophen-2-yl]phenyl]guanidine;dihydrochloride |
| SMILES | Cc1ccc(/N=C(\N)Nc2ccc(-c3ccc(-c4ccc(N/C(N)=N/c5ccc(C)cc5)cc4)s3)cc2)cc1.Cl.Cl |
| InChI | InChI=1S/C32H30N6S.2ClH/c1-21-3-11-25(12-4-21)35-31(33)37-27-15-7-23(8-16-27)29-19-20-30(39-29)24-9-17-28(18-10-24)38-32(34)36-26-13-5-22(2)6-14-26;;/h3-20H,1-2H3,(H3,33,35,37)(H3,34,36,38);2*1H |
| InChIKey | XHZWFIXKCCAVCB-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|