About 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane
9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane (PubChem CID 166555285) has the molecular formula C22H25NOS
and a molecular weight of 351.52 g/mol. Its IUPAC name is 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane.
Molecular Properties
| Compound Name | 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane |
| PubChem CID | 166555285 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane |
| SMILES | C.C=O.CCn1c2ccc(C)cc2c2ccc(-c3cc(C)cs3)cc21 |
| InChI | InChI=1S/C20H19NS.CH2O.CH4/c1-4-21-18-8-5-13(2)9-17(18)16-7-6-15(11-19(16)21)20-10-14(3)12-22-20;1-2;/h5-12H,4H2,1-3H3;1H2;1H4 |
| InChIKey | UPEGWBNOCITIDF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane?
The IUPAC name of 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane (CID 166555285) is 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane.
What is the SMILES notation for 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane?
The canonical SMILES for 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane is C.C=O.CCn1c2ccc(C)cc2c2ccc(-c3cc(C)cs3)cc21.
What is the InChIKey of 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane?
The InChIKey is UPEGWBNOCITIDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NS.CH2O.CH4/c1-4-21-18-8-5-13(2)9-17(18)16-7-6-15(11-19(16)21)20-10-14(3)12-22-20;1-2;/h5-12H,4H2,1-3H3;1H2;1H4.
What are the key properties of 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane?
9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane has a molecular weight of 351.52 g/mol, XLogP of 6.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-6-methyl-2-(4-methylthiophen-2-yl)carbazole;formaldehyde;methane is sourced from PubChem (CID 166555285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).