About 2-acetamidonon-8-enoic acid
2-acetamidonon-8-enoic acid (PubChem CID 16655536) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-acetamidonon-8-enoic acid.
Molecular Properties
| Compound Name | 2-acetamidonon-8-enoic acid |
| PubChem CID | 16655536 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-acetamidonon-8-enoic acid |
| SMILES | C=CCCCCCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C11H19NO3/c1-3-4-5-6-7-8-10(11(14)15)12-9(2)13/h3,10H,1,4-8H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | ZVOCMVHWFJWMEB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidonon-8-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidonon-8-enoic acid?
The IUPAC name of 2-acetamidonon-8-enoic acid (CID 16655536) is 2-acetamidonon-8-enoic acid.
What is the SMILES notation for 2-acetamidonon-8-enoic acid?
The canonical SMILES for 2-acetamidonon-8-enoic acid is C=CCCCCCC(NC(C)=O)C(=O)O.
What is the InChIKey of 2-acetamidonon-8-enoic acid?
The InChIKey is ZVOCMVHWFJWMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-3-4-5-6-7-8-10(11(14)15)12-9(2)13/h3,10H,1,4-8H2,2H3,(H,12,13)(H,14,15).
What are the key properties of 2-acetamidonon-8-enoic acid?
2-acetamidonon-8-enoic acid has a molecular weight of 213.28 g/mol, XLogP of 1.71, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidonon-8-enoic acid is sourced from PubChem (CID 16655536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).