2-acetamidonon-8-enoic acid

C11H19NO3 — CID 16655536

IUPAC2-acetamidonon-8-enoic acid
SMILESC=CCCCCCC(NC(C)=O)C(=O)O
InChIInChI=1S/C11H19NO3/c1-3-4-5-6-7-8-10(11(14)15)12-9(2)13/h3,10H,1,4-8H2,2H3,(H,12,13)(H,14,15)
InChIKeyZVOCMVHWFJWMEB-UHFFFAOYSA-N
MW213.28 g/mol
LogP1.71
Rot. Bonds8

About 2-acetamidonon-8-enoic acid

2-acetamidonon-8-enoic acid (PubChem CID 16655536) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-acetamidonon-8-enoic acid.

Molecular Properties

Compound Name2-acetamidonon-8-enoic acid
PubChem CID16655536
Molecular FormulaC11H19NO3
Molecular Weight213.28 g/mol
Exact Mass213.14
IUPAC Name2-acetamidonon-8-enoic acid
SMILESC=CCCCCCC(NC(C)=O)C(=O)O
InChIInChI=1S/C11H19NO3/c1-3-4-5-6-7-8-10(11(14)15)12-9(2)13/h3,10H,1,4-8H2,2H3,(H,12,13)(H,14,15)
InChIKeyZVOCMVHWFJWMEB-UHFFFAOYSA-N
XLogP1.71
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.28
LogP ≤ 51.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-acetamidonon-8-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamidonon-8-enoic acid?
The IUPAC name of 2-acetamidonon-8-enoic acid (CID 16655536) is 2-acetamidonon-8-enoic acid.
What is the SMILES notation for 2-acetamidonon-8-enoic acid?
The canonical SMILES for 2-acetamidonon-8-enoic acid is C=CCCCCCC(NC(C)=O)C(=O)O.
What is the InChIKey of 2-acetamidonon-8-enoic acid?
The InChIKey is ZVOCMVHWFJWMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-3-4-5-6-7-8-10(11(14)15)12-9(2)13/h3,10H,1,4-8H2,2H3,(H,12,13)(H,14,15).
What are the key properties of 2-acetamidonon-8-enoic acid?
2-acetamidonon-8-enoic acid has a molecular weight of 213.28 g/mol, XLogP of 1.71, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidonon-8-enoic acid is sourced from PubChem (CID 16655536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).