C25H22N4O5 — CID 166555473
4-[3-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-5-hydroxyphenyl]benzoic acid (PubChem CID 166555473) has the molecular formula C25H22N4O5 and a molecular weight of 458.47 g/mol. Its IUPAC name is 4-[3-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-5-hydroxyphenyl]benzoic acid.
| Compound Name | 4-[3-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-5-hydroxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 166555473 |
| Molecular Formula | C25H22N4O5 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 4-[3-[4-[(2-ethoxyphenyl)diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]-5-hydroxyphenyl]benzoic acid |
| SMILES | CCOc1ccccc1/N=N/c1c(C)[nH]n(-c2cc(O)cc(-c3ccc(C(=O)O)cc3)c2)c1=O |
| InChI | InChI=1S/C25H22N4O5/c1-3-34-22-7-5-4-6-21(22)26-27-23-15(2)28-29(24(23)31)19-12-18(13-20(30)14-19)16-8-10-17(11-9-16)25(32)33/h4-14,28,30H,3H2,1-2H3,(H,32,33)/b27-26+ |
| InChIKey | FZNSTQBRTZAOCV-CYYJNZCTSA-N |
| XLogP | 5.36 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|