C36H48BrClN6O2S — CID 166555953
1-[[1-(4-bromobutyl)pyrazol-4-yl]methyl]-3-methylpiperazine;1-[[7-(5-chloro-2,3-dimethylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-3-methylpyrrolidine-2,5-dione;ethane (PubChem CID 166555953) has the molecular formula C36H48BrClN6O2S and a molecular weight of 744.24 g/mol. Its IUPAC name is 1-[[1-(4-bromobutyl)pyrazol-4-yl]methyl]-3-methylpiperazine;1-[[7-(5-chloro-2,3-dimethylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-3-methylpyrrolidine-2,5-dione;ethane.
| Compound Name | 1-[[1-(4-bromobutyl)pyrazol-4-yl]methyl]-3-methylpiperazine;1-[[7-(5-chloro-2,3-dimethylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-3-methylpyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 166555953 |
| Molecular Formula | C36H48BrClN6O2S |
| Molecular Weight | 744.24 g/mol |
| Exact Mass | 742.24 |
| IUPAC Name | 1-[[1-(4-bromobutyl)pyrazol-4-yl]methyl]-3-methylpiperazine;1-[[7-(5-chloro-2,3-dimethylphenyl)thieno[3,2-b]pyridin-2-yl]methyl]-3-methylpyrrolidine-2,5-dione;ethane |
| SMILES | CC.CC1CN(Cc2cnn(CCCCBr)c2)CCN1.Cc1cc(Cl)cc(-c2ccnc3cc(CN4C(=O)CC(C)C4=O)sc23)c1C |
| InChI | InChI=1S/C21H19ClN2O2S.C13H23BrN4.C2H6/c1-11-6-14(22)8-17(13(11)3)16-4-5-23-18-9-15(27-20(16)18)10-24-19(25)7-12(2)21(24)26;1-12-9-17(7-5-15-12)10-13-8-16-18(11-13)6-3-2-4-14;1-2/h4-6,8-9,12H,7,10H2,1-3H3;8,11-12,15H,2-7,9-10H2,1H3;1-2H3 |
| InChIKey | OFPXCEDUHCHXFX-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.24 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|